CAS 16869-24-2 appears in our catalog under these names: 4-Nitrobenzyl 2-bromoacetate, 4-Nitrobenzyl 2-bromoacetate 98%, 4-Nitrobenzyl 2-bromoacetate, 97%, 97%, 4-Nitrobenzyl bromoacetate, 95%, 4–Nitrobenzyl bromoacetate. Offered by: Fluorochem, Ambeed, Chemat, Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g, 10g.
(4-nitrophenyl)methyl 2-bromoacetate (CAS 16869-24-2) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: (4-nitrophenyl)methyl 2-bromoacetate. InChIKey: ADHFTAKIDKDGBV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | (4-nitrophenyl)methyl 2-bromoacetate |
| InChIKey | ADHFTAKIDKDGBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)