CAS 147249-30-7 appears in our catalog under these names: 2-(Difluoromethoxy)-5-methylbenzaldehyde, 95%, 2-(Difluoromethoxy)-5-methylbenzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-(difluoromethoxy)-5-methylbenzaldehyde (CAS 147249-30-7) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 2-(difluoromethoxy)-5-methylbenzaldehyde. InChIKey: GCAPSKHMYYUTMB-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 2-(difluoromethoxy)-5-methylbenzaldehyde |
| InChIKey | GCAPSKHMYYUTMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(F)F)C=O |
Computed by PubChem (NCBI)