Products 14770-85-5
CAS 14770-85-5 appears in our catalog under these names: 5–Phenylthiophen–2–amine, 5-Phenylthiophen-2-amine 95%, 5-Phenylthiophen-2-amine, 95%, 5-Phenylthiophen-2-amine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g.
5-phenylthiophen-2-amine (CAS 14770-85-5) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 5-phenylthiophen-2-amine. InChIKey: RKBJFUYQLLNSII-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 5-phenylthiophen-2-amine |
| InChIKey | RKBJFUYQLLNSII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(S2)N |
Computed by PubChem (NCBI)