CAS 14770-96-8 appears in our catalog under these names: 2-Benzoyl-4-methoxyphenol, 95%, 2-Benzoyl-4-methoxyphenol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g.
(2-hydroxy-5-methoxyphenyl)-phenylmethanone (CAS 14770-96-8) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: (2-hydroxy-5-methoxyphenyl)-phenylmethanone. InChIKey: RIFCEURUCJPMOQ-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | (2-hydroxy-5-methoxyphenyl)-phenylmethanone |
| InChIKey | RIFCEURUCJPMOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)