CAS 147983-65-1 is the registry number for Methyl 2-(4-aminophenyl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 250g, 500g, 1000g.
Methyl 2-(4-aminophenyl)-2-oxoacetate (CAS 147983-65-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 2-(4-aminophenyl)-2-oxoacetate. InChIKey: NAHHESPRHNGMCQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 2-(4-aminophenyl)-2-oxoacetate |
| InChIKey | NAHHESPRHNGMCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)