Products 147983-65-1

CAS 147983-65-1 is the registry number for Methyl 2-(4-aminophenyl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 250g, 500g, 1000g.

Structural formula: {0} (CAS {1})

Methyl 2-(4-aminophenyl)-2-oxoacetate (CAS 147983-65-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 2-(4-aminophenyl)-2-oxoacetate. InChIKey: NAHHESPRHNGMCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO3
Molecular weight179.17 g/mol
IUPAC namemethyl 2-(4-aminophenyl)-2-oxoacetate
InChIKeyNAHHESPRHNGMCQ-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)C1=CC=C(C=C1)N

Computed by PubChem (NCBI)