CAS 1485-00-3 appears in our catalog under these names: 3,4-Methylenedioxy-beta-nitrostyrene, 98%, MDBN, MNS, MNS/ 98.45% (existing batch purity), MNS, >98.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, TargetMol, TCI. Available pack sizes: 1g, 25g, 5g, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg.
5-[(E)-2-nitroethenyl]-1,3-benzodioxole (CAS 1485-00-3) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 5-[(E)-2-nitroethenyl]-1,3-benzodioxole. InChIKey: KFLWBZPSJQPRDD-ONEGZZNKSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-[(E)-2-nitroethenyl]-1,3-benzodioxole |
| InChIKey | KFLWBZPSJQPRDD-ONEGZZNKSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)