CAS 22568-48-5 appears in our catalog under these names: 5-(2-Nitroethenyl)-2H-1,3-benzodioxole, 5-(2-nitroethenyl)-2H-1,3-benzodioxole, 98%, (E)-5-(2-Nitrovinyl)benzo(d)(1,3)dioxole, 98%, (E)-5-(2-Nitrovinyl)benzo[d][1,3]dioxole, 98%, 98%. Offered by: Biosynth, Fluorochem, AmBeed, Chemat. Available pack sizes: 2,5g, 0,25g, 1g, 5g, 10g, 25g, 100g, 250g.
5-[(E)-2-nitroethenyl]-1,3-benzodioxole (CAS 22568-48-5) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 5-[(E)-2-nitroethenyl]-1,3-benzodioxole. InChIKey: KFLWBZPSJQPRDD-ONEGZZNKSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-[(E)-2-nitroethenyl]-1,3-benzodioxole |
| InChIKey | KFLWBZPSJQPRDD-ONEGZZNKSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)