CAS 148516-69-2 appears in our catalog under these names: Amisulpride Impurity 17, Amisulpride Impurity 19, Amisulpride Impurity 39. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 4-amino-5-ethylsulfonyl-2-hydroxybenzoate (CAS 148516-69-2) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: methyl 4-amino-5-ethylsulfonyl-2-hydroxybenzoate. InChIKey: UCIRETIXNHAHQT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | methyl 4-amino-5-ethylsulfonyl-2-hydroxybenzoate |
| InChIKey | UCIRETIXNHAHQT-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)OC)O)N |
Computed by PubChem (NCBI)