Products 148517-84-4
CAS 148517-84-4 is the registry number for 7-Hydroxy-6,7-dihydro-5H-indeno[5,6-d][1,3]dioxol-5-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5-hydroxy-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one (CAS 148517-84-4) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 5-hydroxy-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one. InChIKey: WOWJGPHAZSPZAP-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-hydroxy-5,6-dihydrocyclopenta[f][1,3]benzodioxol-7-one |
| InChIKey | WOWJGPHAZSPZAP-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC3=C(C=C2C1=O)OCO3)O |
Computed by PubChem (NCBI)