CAS 149243-19-6 appears in our catalog under these names: (Z)-3-(3,5-Dimethoxyphenyl)acrylic acid, 98%, (Z)–3–(3，5–dimethoxyphenyl)acrylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
(Z)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid (CAS 149243-19-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (Z)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid. InChIKey: VLSRUFWCGBMYDJ-ARJAWSKDSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (Z)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | VLSRUFWCGBMYDJ-ARJAWSKDSA-N |
| SMILES | COC1=CC(=CC(=C1)/C=C\C(=O)O)OC |
Computed by PubChem (NCBI)