Products 20767-04-8
CAS 20767-04-8 appears in our catalog under these names: (E)-3-(3,5-Dimethoxyphenyl)acrylic acid, 98%, 98%, (E)-3-(3,5-Dimethoxyphenyl)acrylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
(E)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid (CAS 20767-04-8) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (E)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid. InChIKey: VLSRUFWCGBMYDJ-ONEGZZNKSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (E)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | VLSRUFWCGBMYDJ-ONEGZZNKSA-N |
| SMILES | COC1=CC(=CC(=C1)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(3,5-Dimethoxyphenyl)-2-propenoic acid, 3-(3,5-dimethoxyphenyl)acrylic acid, (E)-3-(3,5-dimethoxyphenyl)acrylic acid, 3,5-Dimethoxycinnamic acid, predominantly trans, (E)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid, (2E)-3-(3,5-dimethoxyphenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(3,5-dimethoxyphenyl)-, (2E)-, Cinnamic acid, 3,5-dimethoxy-, (e)-3,5-dimethoxycinnamic acid, 3-(3,5-dimethoxyphenyl)acrylicacid