Products 16909-11-8
CAS 16909-11-8 appears in our catalog under these names: 3,5–Dimethoxycinnamic acid, predominantly trans, 3,5-DIMETHOXYCINNAMIC ACID, 99+%, &, 3-(3,5-Dimethoxyphenyl)acrylic acid, 98% (E), 98% (E), 3,5-Dimethoxycinnamic acid, min. 95 %, 50 g, 3,5-Dimethoxycinnamic acid, min. 95 %, 100 g. Offered by: GLPBio, Sigma-Aldrich, Chemat, Roth, Fluorochem. Available pack sizes: 25g, 5g, 10G, 1g, 100g, 50g, 250g, 500g.
3-(3,5-dimethoxyphenyl)prop-2-enoic acid (CAS 16909-11-8) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-(3,5-dimethoxyphenyl)prop-2-enoic acid. InChIKey: VLSRUFWCGBMYDJ-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-(3,5-dimethoxyphenyl)prop-2-enoic acid |
| InChIKey | VLSRUFWCGBMYDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C=CC(=O)O)OC |
Computed by PubChem (NCBI)