CAS 149506-48-9 is the registry number for 2-Amino-2,3-dihydro-1H-indene-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CAS 149506-48-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride. InChIKey: IZPMCQYSYQAJSU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride |
| InChIKey | IZPMCQYSYQAJSU-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)C(=O)O)N.Cl |
Computed by PubChem (NCBI)