Products 149506-48-9

CAS 149506-48-9 is the registry number for 2-Amino-2,3-dihydro-1H-indene-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CAS 149506-48-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride. InChIKey: IZPMCQYSYQAJSU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO2
Molecular weight213.66 g/mol
IUPAC name2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride
InChIKeyIZPMCQYSYQAJSU-UHFFFAOYSA-N
SMILESC1C(CC2=C1C=CC(=C2)C(=O)O)N.Cl

Computed by PubChem (NCBI)