CAS 149520-09-2 is the registry number for Ethyl (S)-3-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3S)-3-amino-3-(1,3-benzodioxol-5-yl)propanoate (CAS 149520-09-2) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: ethyl (3S)-3-amino-3-(1,3-benzodioxol-5-yl)propanoate. InChIKey: CUMDNQXYGSSDHW-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | ethyl (3S)-3-amino-3-(1,3-benzodioxol-5-yl)propanoate |
| InChIKey | CUMDNQXYGSSDHW-VIFPVBQESA-N |
| SMILES | CCOC(=O)C[C@@H](C1=CC2=C(C=C1)OCO2)N |
Computed by PubChem (NCBI)