CAS 149709-63-7 appears in our catalog under these names: Sacubitril-(2S,4S)-Isomer, (2S,4S)-Sacubitril, 2S,4S–Sacubitril, 4-(((2S,4S)-1-([1,1'-Biphenyl]-4-yl)-5-ethoxy-4-methyl-5-oxopentan-2-yl)amino)-4-oxobutanoic acid, 98%, 98%, (2S,4S)-Sacubitril, 98.33%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 1mg, 10mM (in 1ml dmso), 25mg, 50mg.
4-[[(2S,4S)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid (CAS 149709-63-7) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: 4-[[(2S,4S)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid. InChIKey: PYNXFZCZUAOOQC-UWJYYQICSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 4-[[(2S,4S)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | PYNXFZCZUAOOQC-UWJYYQICSA-N |
| SMILES | CCOC(=O)[C@@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)