CAS 149794-10-5 appears in our catalog under these names: Boc–N–Ethylglycine, N-Boc-N-ethylglycine, 97% , Boc-N-Ethylglycine, Boc-N-Et-Gly-OH 97%, Boc-N-Ethylglycine, 98.98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 500g, 1g, 5g, 2g, 250mg.
2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (CAS 149794-10-5) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid. InChIKey: SPBIXXXFDSLALC-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| InChIKey | SPBIXXXFDSLALC-UHFFFAOYSA-N |
| SMILES | CCN(CC(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)