Products 149947-04-6
CAS 149947-04-6 is the registry number for 1-(3-bromo-2,6-difluorophenyl)prop-2-en-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(3-bromo-2,6-difluorophenyl)prop-2-en-1-ol (CAS 149947-04-6) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 1-(3-bromo-2,6-difluorophenyl)prop-2-en-1-ol. InChIKey: GTIMXEMJFMRWDC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 1-(3-bromo-2,6-difluorophenyl)prop-2-en-1-ol |
| InChIKey | GTIMXEMJFMRWDC-UHFFFAOYSA-N |
| SMILES | C=CC(C1=C(C=CC(=C1F)Br)F)O |
Computed by PubChem (NCBI)