Products 1500287-53-5

CAS 1500287-53-5 is the registry number for 2-(2,2,2-Trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2,2,2-trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid (CAS 1500287-53-5) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid. InChIKey: LEEJDIOLWLQOQP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F3NO3
Molecular weight245.15 g/mol
IUPAC name2-(2,2,2-trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid
InChIKeyLEEJDIOLWLQOQP-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)N=C(O2)CC(F)(F)F

Computed by PubChem (NCBI)