CAS 1500287-53-5 is the registry number for 2-(2,2,2-Trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,2,2-trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid (CAS 1500287-53-5) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid. InChIKey: LEEJDIOLWLQOQP-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethyl)-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | LEEJDIOLWLQOQP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)N=C(O2)CC(F)(F)F |
Computed by PubChem (NCBI)