Products 2648588-70-7
CAS 2648588-70-7 is the registry number for 3-(Cyanomethyl)-5-(trifluoromethoxy)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(cyanomethyl)-5-(trifluoromethoxy)benzoic acid (CAS 2648588-70-7) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 3-(cyanomethyl)-5-(trifluoromethoxy)benzoic acid. InChIKey: AYXLMTCIUIJQKW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | 3-(cyanomethyl)-5-(trifluoromethoxy)benzoic acid |
| InChIKey | AYXLMTCIUIJQKW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)OC(F)(F)F)CC#N |
Computed by PubChem (NCBI)