Products 890095-37-1
CAS 890095-37-1 appears in our catalog under these names: 3-nitro-2-(trifluoromethyl)-2{H}-chromene, 98%, 98%, 3-Nitro-2-(trifluoromethyl)-2H-chromene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1mg.
3-nitro-2-(trifluoromethyl)-2H-chromene (CAS 890095-37-1) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 3-nitro-2-(trifluoromethyl)-2H-chromene. InChIKey: BGTJUOYBNMSGRC-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | 3-nitro-2-(trifluoromethyl)-2H-chromene |
| InChIKey | BGTJUOYBNMSGRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(O2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)