CAS 856165-85-0 is the registry number for 3-cyano-4-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-cyano-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 856165-85-0) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 3-cyano-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: FGLGDRMGIUPUBH-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | 3-cyano-4-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | FGLGDRMGIUPUBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C#N)OCC(F)(F)F |
Computed by PubChem (NCBI)