CAS 923259-70-5 appears in our catalog under these names: 6-(Trifluoromethoxy)-1H-indole-2-carboxylic acid, 98%, 98%, 6-(Trifluoromethoxy)-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
6-(trifluoromethoxy)-1H-indole-2-carboxylic acid (CAS 923259-70-5) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 6-(trifluoromethoxy)-1H-indole-2-carboxylic acid. InChIKey: FOJBKFGWDZMUCC-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1H-indole-2-carboxylic acid |
| InChIKey | FOJBKFGWDZMUCC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)