CAS 926208-37-9 is the registry number for 4-(Trifluoromethoxy)-1H-Indole-2-Carboxylic Acid. Offered by: TRC. Available pack sizes: 750mg.
4-(trifluoromethoxy)-1H-indole-2-carboxylic acid (CAS 926208-37-9) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: 4-(trifluoromethoxy)-1H-indole-2-carboxylic acid. InChIKey: NXLKLROWBALFPC-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | 4-(trifluoromethoxy)-1H-indole-2-carboxylic acid |
| InChIKey | NXLKLROWBALFPC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(N2)C(=O)O)C(=C1)OC(F)(F)F |
Computed by PubChem (NCBI)