Products 2112621-18-6
CAS 2112621-18-6 is the registry number for Methyl 6-(trifluoromethyl)benzo[c]isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-(trifluoromethyl)-2,1-benzoxazole-3-carboxylate (CAS 2112621-18-6) is a chemical compound with the molecular formula C10H6F3NO3 and a molecular weight of 245.15 g/mol. IUPAC name: methyl 6-(trifluoromethyl)-2,1-benzoxazole-3-carboxylate. InChIKey: GAUCCGAGLUSSDM-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO3 |
|---|---|
| Molecular weight | 245.15 g/mol |
| IUPAC name | methyl 6-(trifluoromethyl)-2,1-benzoxazole-3-carboxylate |
| InChIKey | GAUCCGAGLUSSDM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC(=CC2=NO1)C(F)(F)F |
Computed by PubChem (NCBI)