CAS 1500962-93-5 is the registry number for 7-Chloro-1,5-dimethyl-1H-pyrazolo[4,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1,5-dimethylpyrazolo[4,5-d]pyrimidine (CAS 1500962-93-5) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 7-chloro-1,5-dimethylpyrazolo[4,5-d]pyrimidine. InChIKey: XJAUVZUFRYLSCF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-chloro-1,5-dimethylpyrazolo[4,5-d]pyrimidine |
| InChIKey | XJAUVZUFRYLSCF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)Cl)N(N=C2)C |
Computed by PubChem (NCBI)