Products 15015-57-3
CAS 15015-57-3 appears in our catalog under these names: Elastase-IN-3, 99.71%, Elastase-IN-3, 98%, Bis(4-hydroxyphenyl) Disulfide, >98.0%(GC), Bis(4-hydroxyphenyl) Disulfide, 98%, 98%, Bis(4-hydroxyphenyl) Disulfide, 98%. Offered by: MedChemExpress, Ambeed, TCI, Chemat, BLDpharm. Available pack sizes: 10mM/1mL, 10 g, 25 g, 5 g, 50 g, 100 g, 500 g, 1 g.
4-[(4-hydroxyphenyl)disulfanyl]phenol (CAS 15015-57-3) is a chemical compound with the molecular formula C12H10O2S2 and a molecular weight of 250.3 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)disulfanyl]phenol. InChIKey: XGKGITBBMXTKTE-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)disulfanyl]phenol |
| InChIKey | XGKGITBBMXTKTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)SSC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)