CAS 150190-28-6 appears in our catalog under these names: 6-Cyclopropyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 95%, 6-cyclopropyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 6-Cyclopropyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, TRC, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 10mg, 25mg, 5mg, 50mg, 0,5g, 100mg.
2-cyclopropyl-6-oxo-1H-pyridine-4-carboxylic acid (CAS 150190-28-6) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-cyclopropyl-6-oxo-1H-pyridine-4-carboxylic acid. InChIKey: SRFWIYLEHUULCU-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-cyclopropyl-6-oxo-1H-pyridine-4-carboxylic acid |
| InChIKey | SRFWIYLEHUULCU-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=CC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)