CAS 150208-27-8 is the registry number for 1-(2-(3,4-Dichlorophenyl)ethyl)piperazine. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g.
1-[2-(3,4-dichlorophenyl)ethyl]piperazine (CAS 150208-27-8) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: 1-[2-(3,4-dichlorophenyl)ethyl]piperazine. InChIKey: OWINIGBJQWGIJU-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 1-[2-(3,4-dichlorophenyl)ethyl]piperazine |
| InChIKey | OWINIGBJQWGIJU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)