CAS 62957-18-0 is the registry number for N2,N2-Dimethylnaphthalene-2,6-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-N,2-N-dimethylnaphthalene-2,6-diamine;dihydrochloride (CAS 62957-18-0) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: 2-N,2-N-dimethylnaphthalene-2,6-diamine;dihydrochloride. InChIKey: OTOFTYVXAUIKHI-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 2-N,2-N-dimethylnaphthalene-2,6-diamine;dihydrochloride |
| InChIKey | OTOFTYVXAUIKHI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)