Products 1502511-37-6
CAS 1502511-37-6 is the registry number for ethyl 2-(2-chloro-5-methoxyphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(2-chloro-5-methoxyphenyl)-2-oxoacetate (CAS 1502511-37-6) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: ethyl 2-(2-chloro-5-methoxyphenyl)-2-oxoacetate. InChIKey: UTGYNTCXTYDRCZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | ethyl 2-(2-chloro-5-methoxyphenyl)-2-oxoacetate |
| InChIKey | UTGYNTCXTYDRCZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=CC(=C1)OC)Cl |
Computed by PubChem (NCBI)