CAS 1503746-05-1 is the registry number for 2-Chloro-4-(1-methyl-1H-pyrazol-5-yl)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-4-(2-methylpyrazol-3-yl)pyrimidine (CAS 1503746-05-1) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-4-(2-methylpyrazol-3-yl)pyrimidine. InChIKey: NZMZFBFHNYJTPY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-4-(2-methylpyrazol-3-yl)pyrimidine |
| InChIKey | NZMZFBFHNYJTPY-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)