CAS 15052-05-8 appears in our catalog under these names: 5,6,7,8-Tetrahydro-1,3-Dioxolo(4,5-g)isoquinoline Hydrochloride, TDIQ (hydrochloride), TDIQ (hydrochloride). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 1 mg, 5 mg.
5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride (CAS 15052-05-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride. InChIKey: DOJLHSBHORQYDE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinoline;hydrochloride |
| InChIKey | DOJLHSBHORQYDE-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC3=C(C=C21)OCO3.Cl |
Computed by PubChem (NCBI)