CAS 1507967-83-0 appears in our catalog under these names: 3,3-Difluoro-3-phenylpropanoic acid, 95%, 3,3-Difluoro-3-phenylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3-difluoro-3-phenylpropanoic acid (CAS 1507967-83-0) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 3,3-difluoro-3-phenylpropanoic acid. InChIKey: RQWQHUMEKKWWMN-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 3,3-difluoro-3-phenylpropanoic acid |
| InChIKey | RQWQHUMEKKWWMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)(F)F |
Computed by PubChem (NCBI)