CAS 1508966-07-1 appears in our catalog under these names: 6-Amino-1,5-naphthyridine-3-carboxylic acid, 95%, 6-Amino-1,5-naphthyridine-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-amino-1,5-naphthyridine-3-carboxylic acid (CAS 1508966-07-1) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 6-amino-1,5-naphthyridine-3-carboxylic acid. InChIKey: HMOXPMFGZPBQON-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 6-amino-1,5-naphthyridine-3-carboxylic acid |
| InChIKey | HMOXPMFGZPBQON-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CC(=C2)C(=O)O)N |
Computed by PubChem (NCBI)