Products 151104-64-2
CAS 151104-64-2 is the registry number for 3-(Chlorosulfonyl)-4,5-dimethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-chlorosulfonyl-4,5-dimethylbenzoic acid (CAS 151104-64-2) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: 3-chlorosulfonyl-4,5-dimethylbenzoic acid. InChIKey: QQSJQUSYMFGYHR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | 3-chlorosulfonyl-4,5-dimethylbenzoic acid |
| InChIKey | QQSJQUSYMFGYHR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)