CAS 1511084-71-1 is the registry number for 2-(2,6-Dichlorophenylamino-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-[2-(2,6-dichloroanilino)-1,3-thiazol-4-yl]acetic acid (CAS 1511084-71-1) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 2-[2-(2,6-dichloroanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: BJJJREALTBRSPP-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 2-[2-(2,6-dichloroanilino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | BJJJREALTBRSPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC2=NC(=CS2)CC(=O)O)Cl |
Computed by PubChem (NCBI)