CAS 314051-88-2 is the registry number for ((2,5-dichlorophenyl)sulfonyl)-2-pyridylamine. Offered by: Biosynth. Available pack sizes: 10g, 25g.
2,5-dichloro-N-pyridin-2-ylbenzenesulfonamide (CAS 314051-88-2) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 2,5-dichloro-N-pyridin-2-ylbenzenesulfonamide. InChIKey: BZDFKUYNBYPTQR-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 2,5-dichloro-N-pyridin-2-ylbenzenesulfonamide |
| InChIKey | BZDFKUYNBYPTQR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)