Products 927983-67-3

CAS 927983-67-3 is the registry number for 2-(4-(3,5-Dichlorophenylamino)-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid (CAS 927983-67-3) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: NCOJLVAZZSOBPA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8Cl2N2O2S
Molecular weight303.2 g/mol
IUPAC name2-[2-(3,5-dichloroanilino)-1,3-thiazol-4-yl]acetic acid
InChIKeyNCOJLVAZZSOBPA-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)NC2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)