Products 211102-91-9
CAS 211102-91-9 is the registry number for 2-(3,4-Dichlorophenylamino-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]acetic acid (CAS 211102-91-9) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: JKHLKFJUVVQIJU-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | JKHLKFJUVVQIJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC(=CS2)CC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)