CAS 928003-09-2 is the registry number for 2-((2,4-Dichlorophenyl)amino)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-(2,4-dichloroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 928003-09-2) is a chemical compound with the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.2 g/mol. IUPAC name: 2-(2,4-dichloroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: UKYWLRXGZYJQPQ-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 2-(2,4-dichloroanilino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | UKYWLRXGZYJQPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)