Products 1511676-97-3
CAS 1511676-97-3 is the registry number for 2-Amino-7-methoxy-1,3-benzoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-7-methoxy-1,3-benzoxazole-5-carboxylic acid (CAS 1511676-97-3) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 2-amino-7-methoxy-1,3-benzoxazole-5-carboxylic acid. InChIKey: AADJXLKGYKGZAT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-amino-7-methoxy-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | AADJXLKGYKGZAT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1OC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)