CAS 17348-71-9 is the registry number for Ethyl benzofuroxan-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylate (CAS 17348-71-9) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: ethyl 1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylate. InChIKey: PNSWPHLJTBSRJR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | ethyl 1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylate |
| InChIKey | PNSWPHLJTBSRJR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=NO[N+](=C2C=C1)[O-] |
Computed by PubChem (NCBI)