Products 5198-51-6
CAS 5198-51-6 is the registry number for 3-(3-Nitrophenyl)-1,3-oxazolidin-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(3-nitrophenyl)-1,3-oxazolidin-2-one (CAS 5198-51-6) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 3-(3-nitrophenyl)-1,3-oxazolidin-2-one. InChIKey: DIAJMQOAAXLQTP-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-1,3-oxazolidin-2-one |
| InChIKey | DIAJMQOAAXLQTP-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)