Products 17122-78-0
CAS 17122-78-0 appears in our catalog under these names: 4-([(2E)-2-(Hydroxyimino)ethanoyl]amino)benzoic acid, 95%, 4-{((2E)-2-(Hydroxyimino)ethanoyl)amino}benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-[(2-hydroxyiminoacetyl)amino]benzoic acid (CAS 17122-78-0) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 4-[(2-hydroxyiminoacetyl)amino]benzoic acid. InChIKey: SDTJRMCHWCUSBN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 4-[(2-hydroxyiminoacetyl)amino]benzoic acid |
| InChIKey | SDTJRMCHWCUSBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)C=NO |
Computed by PubChem (NCBI)