Products 32418-07-8
CAS 32418-07-8 is the registry number for 3-Ethyl-6-nitro-1,3-benzoxazol-2-one, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
3-ethyl-6-nitro-1,3-benzoxazol-2-one (CAS 32418-07-8) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 3-ethyl-6-nitro-1,3-benzoxazol-2-one. InChIKey: KASMUJRVIWHUJM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-ethyl-6-nitro-1,3-benzoxazol-2-one |
| InChIKey | KASMUJRVIWHUJM-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)[N+](=O)[O-])OC1=O |
Computed by PubChem (NCBI)