Products 5198-52-7
CAS 5198-52-7 appears in our catalog under these names: 3-(4-Nitrophenyl)-1,3-oxazolidin-2-one, 95%, 3-(4-Nitrophenyl)-1,3-oxazolidin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(4-nitrophenyl)-1,3-oxazolidin-2-one (CAS 5198-52-7) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 3-(4-nitrophenyl)-1,3-oxazolidin-2-one. InChIKey: HQHDWXOWQVUKNQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-1,3-oxazolidin-2-one |
| InChIKey | HQHDWXOWQVUKNQ-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)