CAS 15158-39-1 is the registry number for Methyl 3,4-diformylbenzoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3,4-diformylbenzoate (CAS 15158-39-1) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 3,4-diformylbenzoate. InChIKey: CUFYRVCCQQFKFF-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 3,4-diformylbenzoate |
| InChIKey | CUFYRVCCQQFKFF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C=O)C=O |
Computed by PubChem (NCBI)