Products 1523571-88-1

CAS 1523571-88-1 is the registry number for 1-(Oxetan-3-yl)piperidin-4-amine oxalate, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 10g, 5g.

Oxalic acid;1-(oxetan-3-yl)piperidin-4-amine (CAS 1523571-88-1) is a chemical compound with the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. IUPAC name: oxalic acid;1-(oxetan-3-yl)piperidin-4-amine. InChIKey: YMFLPRBJWRNZEY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O5
Molecular weight246.26 g/mol
IUPAC nameoxalic acid;1-(oxetan-3-yl)piperidin-4-amine
InChIKeyYMFLPRBJWRNZEY-UHFFFAOYSA-N
SMILESC1CN(CCC1N)C2COC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)