Products 1523618-25-8

CAS 1523618-25-8 is the registry number for tert-Butyl 2,6-diazaspiro[3.4]octane-6-carboxylate hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Bis(tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate);oxalic acid (CAS 1523618-25-8) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate);oxalic acid. InChIKey: LFEWKQXWSHXJNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H42N4O8
Molecular weight514.6 g/mol
IUPAC namebis(tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate);oxalic acid
InChIKeyLFEWKQXWSHXJNQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CNC2.CC(C)(C)OC(=O)N1CCC2(C1)CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)