CAS 1818847-25-4 is the registry number for Cis-oxalic acid bis(tert-butyl-3,8-diazabicyclo[4.2.0]octane-8-carboxylate), 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Bis(tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylate);oxalic acid (CAS 1818847-25-4) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylate);oxalic acid. InChIKey: LVWAGVXLGGSOEA-LVAJUWGCSA-N.
| Molecular formula | C24H42N4O8 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | bis(tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylate);oxalic acid |
| InChIKey | LVWAGVXLGGSOEA-LVAJUWGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]1CNCC2.CC(C)(C)OC(=O)N1C[C@H]2[C@@H]1CNCC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)